C25H26F6N4O4 — CID 166159829
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-(piperazine-1-carbonyl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166159829) has the molecular formula C25H26F6N4O4 and a molecular weight of 560.50 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-(piperazine-1-carbonyl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-(piperazine-1-carbonyl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166159829 |
| Molecular Formula | C25H26F6N4O4 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-(piperazine-1-carbonyl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(C(=O)N4CCNCC4)ncc3F)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H26F6N4O4/c1-12-18(13-4-5-14(26)19(28)20(13)38-3)21(39-24(12,2)25(29,30)31)22(36)34-16-10-17(33-11-15(16)27)23(37)35-8-6-32-7-9-35/h4-5,10-12,18,21,32H,6-9H2,1-3H3,(H,33,34,36)/t12-,18-,21+,24+/m0/s1 |
| InChIKey | INKAQLHFQVKKMK-FIVORTTBSA-N |
| XLogP | 3.63 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |