C21H19F6N3O4 — CID 169047173
4-[[(2R,3S,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-3-fluoropyridine-2-carboxamide (PubChem CID 169047173) has the molecular formula C21H19F6N3O4 and a molecular weight of 491.39 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-3-fluoropyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 169047173 |
| Molecular Formula | C21H19F6N3O4 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 4-[[(2R,3S,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-3-fluoropyridine-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C)[C@@](C)(C(F)(F)F)O[C@H]2C(=O)Nc2ccnc(C(N)=O)c2F)ccc(F)c1F |
| InChI | InChI=1S/C21H19F6N3O4/c1-8-12(9-4-5-10(22)13(23)16(9)33-3)17(34-20(8,2)21(25,26)27)19(32)30-11-6-7-29-15(14(11)24)18(28)31/h4-8,12,17H,1-3H3,(H2,28,31)(H,29,30,32)/t8-,12+,17-,20+/m1/s1 |
| InChIKey | CQXINKGVJMCJCT-GMBWWAEGSA-N |
| XLogP | 3.68 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |