C22H20ClF5N2O4 — CID 177360210
(2R,3S,4S,5R)-N-(2-acetyl-6-chloro-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 177360210) has the molecular formula C22H20ClF5N2O4 and a molecular weight of 506.86 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-(2-acetyl-6-chloro-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-(2-acetyl-6-chloro-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 177360210 |
| Molecular Formula | C22H20ClF5N2O4 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (2R,3S,4S,5R)-N-(2-acetyl-6-chloro-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc(Cl)nc3C(C)=O)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H20ClF5N2O4/c1-9-15(11-5-6-12(24)16(25)18(11)33-4)19(34-21(9,3)22(26,27)28)20(32)29-13-7-8-14(23)30-17(13)10(2)31/h5-9,15,19H,1-4H3,(H,29,32)/t9-,15-,19+,21+/m0/s1 |
| InChIKey | CFIHDNCXGXRSLE-VNXQSDSGSA-N |
| XLogP | 5.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|