C20H19F5N4O4 — CID 169046585
6-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrazine-2-carboxamide (PubChem CID 169046585) has the molecular formula C20H19F5N4O4 and a molecular weight of 474.39 g/mol. Its IUPAC name is 6-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrazine-2-carboxamide.
| Compound Name | 6-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169046585 |
| Molecular Formula | C20H19F5N4O4 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 6-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrazine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@@H](C(=O)Nc3cncc(C(N)=O)n3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H19F5N4O4/c1-8-13(9-4-5-10(21)14(22)15(9)32-3)16(33-19(8,2)20(23,24)25)18(31)29-12-7-27-6-11(28-12)17(26)30/h4-8,13,16H,1-3H3,(H2,26,30)(H,28,29,31)/t8-,13-,16-,19+/m0/s1 |
| InChIKey | ZWMRHKNSHIHPQW-JYRFOLITSA-N |
| XLogP | 2.94 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |