C22H23F5N4O6S — CID 177218046
4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-(methanesulfonamido)pyridine-2-carboxamide (PubChem CID 177218046) has the molecular formula C22H23F5N4O6S and a molecular weight of 566.51 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-(methanesulfonamido)pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-(methanesulfonamido)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177218046 |
| Molecular Formula | C22H23F5N4O6S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-6-(methanesulfonamido)pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(NS(C)(=O)=O)nc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H23F5N4O6S/c1-9-15(11-5-6-12(23)16(24)17(11)36-3)18(37-21(9,2)22(25,26)27)20(33)29-10-7-13(19(28)32)30-14(8-10)31-38(4,34)35/h5-9,15,18H,1-4H3,(H2,28,32)(H2,29,30,31,33)/t9-,15-,18+,21+/m0/s1 |
| InChIKey | SHYGYZCQKGUSEY-UJVVSLLCSA-N |
| XLogP | 2.92 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |