C26H28F5N5O6 — CID 176860477
N-[6-carbamoyl-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]morpholine-4-carboxamide (PubChem CID 176860477) has the molecular formula C26H28F5N5O6 and a molecular weight of 601.53 g/mol. Its IUPAC name is N-[6-carbamoyl-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]morpholine-4-carboxamide.
| Compound Name | N-[6-carbamoyl-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 176860477 |
| Molecular Formula | C26H28F5N5O6 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-[6-carbamoyl-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]morpholine-4-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(NC(=O)N4CCOCC4)nc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C26H28F5N5O6/c1-12-18(14-4-5-15(27)19(28)20(14)40-3)21(42-25(12,2)26(29,30)31)23(38)33-13-10-16(22(32)37)34-17(11-13)35-24(39)36-6-8-41-9-7-36/h4-5,10-12,18,21H,6-9H2,1-3H3,(H2,32,37)(H2,33,34,35,38,39)/t12-,18-,21+,25+/m0/s1 |
| InChIKey | QNNSIROLOKLCID-OMEGRREJSA-N |
| XLogP | 3.41 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |