C25H28F5N5O5 — CID 177218116
6-(4-aminobutanoylamino)-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 177218116) has the molecular formula C25H28F5N5O5 and a molecular weight of 573.52 g/mol. Its IUPAC name is 6-(4-aminobutanoylamino)-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-(4-aminobutanoylamino)-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177218116 |
| Molecular Formula | C25H28F5N5O5 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 6-(4-aminobutanoylamino)-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(NC(=O)CCCN)nc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H28F5N5O5/c1-11-18(13-6-7-14(26)19(27)20(13)39-3)21(40-24(11,2)25(28,29)30)23(38)33-12-9-15(22(32)37)34-16(10-12)35-17(36)5-4-8-31/h6-7,9-11,18,21H,4-5,8,31H2,1-3H3,(H2,32,37)(H2,33,34,35,36,38)/t11-,18-,21+,24+/m0/s1 |
| InChIKey | UPSKTFBIERPHBK-FDBLMWCASA-N |
| XLogP | 3.22 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |