C22H23F5N2O5 — CID 167211894
(2S,3R,5S)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-3-(2-ethoxy-3,4-difluorophenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211894) has the molecular formula C22H23F5N2O5 and a molecular weight of 490.43 g/mol. Its IUPAC name is (2S,3R,5S)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-3-(2-ethoxy-3,4-difluorophenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,5S)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-3-(2-ethoxy-3,4-difluorophenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211894 |
| Molecular Formula | C22H23F5N2O5 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (2S,3R,5S)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-3-(2-ethoxy-3,4-difluorophenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | CCOc1c([C@H]2C[C@@](C)(C(F)(F)F)O[C@@H]2C(=O)Nc2ccnc([C@H](O)CO)c2)ccc(F)c1F |
| InChI | InChI=1S/C22H23F5N2O5/c1-3-33-18-12(4-5-14(23)17(18)24)13-9-21(2,22(25,26)27)34-19(13)20(32)29-11-6-7-28-15(8-11)16(31)10-30/h4-8,13,16,19,30-31H,3,9-10H2,1-2H3,(H,28,29,32)/t13-,16-,19+,21+/m1/s1 |
| InChIKey | MVBGICXDUBJVDB-YHZNOWJQSA-N |
| XLogP | 3.62 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |