C21H24F2N3O5+ — CID 161144684
4-[[(2R,3R,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 161144684) has the molecular formula C21H24F2N3O5+ and a molecular weight of 436.44 g/mol. Its IUPAC name is 4-[[(2R,3R,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | 4-[[(2R,3R,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 161144684 |
| Molecular Formula | C21H24F2N3O5+ |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-[[(2R,3R,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@H](C(=O)Nc3cc[n+](O)c(C(N)=O)c3)OC(C)(C)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H23F2N3O5/c1-10-15(12-5-6-13(22)16(23)17(12)30-4)18(31-21(10,2)3)20(28)25-11-7-8-26(29)14(9-11)19(24)27/h5-10,15,18,29H,1-4H3,(H2,24,27)/p+1/t10-,15+,18+/m0/s1 |
| InChIKey | ZNKCLQSTKGCESF-WQFPPAFTSA-O |
| XLogP | 2.13 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|