C21H21F5N3O5+ — CID 170941489
4-[[(2S,3R,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170941489) has the molecular formula C21H21F5N3O5+ and a molecular weight of 490.41 g/mol. Its IUPAC name is 4-[[(2S,3R,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | 4-[[(2S,3R,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170941489 |
| Molecular Formula | C21H21F5N3O5+ |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-[[(2S,3R,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3cc[n+](O)c(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H20F5N3O5/c1-9-14(11-4-5-12(22)15(23)16(11)33-3)17(34-20(9,2)21(24,25)26)19(31)28-10-6-7-29(32)13(8-10)18(27)30/h4-9,14,17,32H,1-3H3,(H2,27,30)/p+1/t9-,14+,17-,20+/m0/s1 |
| InChIKey | HKQYUXQWHAABLQ-WJPGGDJGSA-O |
| XLogP | 2.68 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|