C26H28F5N7O4 — CID 177218370
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-6-(piperazine-1-carbonylamino)-1H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 177218370) has the molecular formula C26H28F5N7O4 and a molecular weight of 597.55 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-6-(piperazine-1-carbonylamino)-1H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-6-(piperazine-1-carbonylamino)-1H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 177218370 |
| Molecular Formula | C26H28F5N7O4 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-6-(piperazine-1-carbonylamino)-1H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | COc1c([C@H]2[C@H](c3nc4c(C(N)=O)nc(NC(=O)N5CCNCC5)cc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C26H28F5N7O4/c1-11-16(12-4-5-13(27)17(28)20(12)41-3)21(42-25(11,2)26(29,30)31)23-34-14-10-15(35-19(22(32)39)18(14)37-23)36-24(40)38-8-6-33-7-9-38/h4-5,10-11,16,21,33H,6-9H2,1-3H3,(H2,32,39)(H,34,37)(H,35,36,40)/t11-,16-,21+,25+/m0/s1 |
| InChIKey | WAKOZBKRJQVNSF-SZLSMLCHSA-N |
| XLogP | 3.59 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |