C22H22F5N3O3S — CID 176860181
[2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-benzimidazol-4-yl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 176860181) has the molecular formula C22H22F5N3O3S and a molecular weight of 503.49 g/mol. Its IUPAC name is [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-benzimidazol-4-yl]-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-benzimidazol-4-yl]-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 176860181 |
| Molecular Formula | C22H22F5N3O3S |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-benzimidazol-4-yl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cccc2[nH]c([C@@H]3O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]3c3ccc(F)c(F)c3OC)nc12 |
| InChI | InChI=1S/C22H22F5N3O3S/c1-10-15(11-8-9-12(23)16(24)18(11)32-3)19(33-21(10,2)22(25,26)27)20-29-13-6-5-7-14(17(13)30-20)34(4,28)31/h5-10,15,19,28H,1-4H3,(H,29,30)/t10-,15-,19+,21+,34?/m0/s1 |
| InChIKey | DWGOACAOMHGOOH-PJFYEXCBSA-N |
| XLogP | 5.70 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |