C21H23F5N2O4 — CID 176996492
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-[(1S)-1-hydroxyethyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 176996492) has the molecular formula C21H23F5N2O4 and a molecular weight of 462.42 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-[(1S)-1-hydroxyethyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-[(1S)-1-hydroxyethyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 176996492 |
| Molecular Formula | C21H23F5N2O4 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-[(1S)-1-hydroxyethyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | COc1c([C@H]2[C@H](c3nc(C)c([C@H](C)O)c(=O)[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H23F5N2O4/c1-8-13(11-6-7-12(22)15(23)16(11)31-5)17(32-20(8,4)21(24,25)26)18-27-9(2)14(10(3)29)19(30)28-18/h6-8,10,13,17,29H,1-5H3,(H,27,28,30)/t8-,10-,13-,17+,20+/m0/s1 |
| InChIKey | DBUMZAZEHTXYAD-UMKICTLDSA-N |
| XLogP | 4.23 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |