C20H19F5N4O2 — CID 178077998
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-3H-imidazo[4,5-c]pyridin-6-amine (PubChem CID 178077998) has the molecular formula C20H19F5N4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-3H-imidazo[4,5-c]pyridin-6-amine.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-3H-imidazo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 178077998 |
| Molecular Formula | C20H19F5N4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-3H-imidazo[4,5-c]pyridin-6-amine |
| SMILES | COc1c([C@H]2[C@H](c3nc4cc(N)ncc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H19F5N4O2/c1-8-14(9-4-5-10(21)15(22)16(9)30-3)17(31-19(8,2)20(23,24)25)18-28-11-6-13(26)27-7-12(11)29-18/h4-8,14,17H,1-3H3,(H2,26,27)(H,28,29)/t8-,14-,17+,19+/m0/s1 |
| InChIKey | RPRCGNHQIPEMEF-NSVWJKCTSA-N |
| XLogP | 4.64 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |