C22H17F6N3O2 — CID 176860388
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-fluoro-1H-benzimidazole-4-carbonitrile (PubChem CID 176860388) has the molecular formula C22H17F6N3O2 and a molecular weight of 469.39 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-fluoro-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-fluoro-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 176860388 |
| Molecular Formula | C22H17F6N3O2 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-fluoro-1H-benzimidazole-4-carbonitrile |
| SMILES | COc1c([C@H]2[C@H](c3nc4c(C#N)c(F)ccc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H17F6N3O2/c1-9-15(10-4-5-13(24)16(25)18(10)32-3)19(33-21(9,2)22(26,27)28)20-30-14-7-6-12(23)11(8-29)17(14)31-20/h4-7,9,15,19H,1-3H3,(H,30,31)/t9-,15-,19+,21+/m0/s1 |
| InChIKey | WKRVTWMCCRBJMT-VNXQSDSGSA-N |
| XLogP | 5.67 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |