C25H21F5N6O4S — CID 176860412
N-[4-carbamoyl-2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-6-yl]-1,3-thiazole-2-carboxamide (PubChem CID 176860412) has the molecular formula C25H21F5N6O4S and a molecular weight of 596.54 g/mol. Its IUPAC name is N-[4-carbamoyl-2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-6-yl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[4-carbamoyl-2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-6-yl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 176860412 |
| Molecular Formula | C25H21F5N6O4S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | N-[4-carbamoyl-2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-6-yl]-1,3-thiazole-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](c3nc4c(C(N)=O)nc(NC(=O)c5nccs5)cc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H21F5N6O4S/c1-9-14(10-4-5-11(26)15(27)18(10)39-3)19(40-24(9,2)25(28,29)30)21-33-12-8-13(34-17(20(31)37)16(12)36-21)35-22(38)23-32-6-7-41-23/h4-9,14,19H,1-3H3,(H2,31,37)(H,33,36)(H,34,35,38)/t9-,14-,19+,24+/m0/s1 |
| InChIKey | GFIISIBYFBLGGF-IAIKWSLYSA-N |
| XLogP | 4.86 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |