C21H20ClF4N5O2 — CID 176860204
2-[(2R,3S,4S,5R)-3-(4-chloro-3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridine-4-carboximidamide (PubChem CID 176860204) has the molecular formula C21H20ClF4N5O2 and a molecular weight of 485.87 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(4-chloro-3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridine-4-carboximidamide.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(4-chloro-3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 176860204 |
| Molecular Formula | C21H20ClF4N5O2 |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(4-chloro-3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccc2[nH]c([C@@H]3O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]3c3ccc(Cl)c(F)c3OC)nc12 |
| InChI | InChI=1S/C21H20ClF4N5O2/c1-8-12(9-4-5-10(22)13(23)16(9)32-3)17(33-20(8,2)21(24,25)26)19-30-11-6-7-29-15(18(27)28)14(11)31-19/h4-8,12,17H,1-3H3,(H3,27,28)(H,30,31)/t8-,12-,17+,20+/m0/s1 |
| InChIKey | ROCXAXSMVWUKIH-HHTRBMLDSA-N |
| XLogP | 4.86 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|