C26H25F4N3O4 — CID 176996253
2-[(2S,3R,4R,5S)-3-(3-cyclopropyl-4-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 176996253) has the molecular formula C26H25F4N3O4 and a molecular weight of 519.50 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-3-(3-cyclopropyl-4-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(2S,3R,4R,5S)-3-(3-cyclopropyl-4-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 176996253 |
| Molecular Formula | C26H25F4N3O4 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-3-(3-cyclopropyl-4-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](c3cc(=O)c4c(C(N)=O)nccc4[nH]3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1C1CC1 |
| InChI | InChI=1S/C26H25F4N3O4/c1-11-18(13-6-7-14(27)19(12-4-5-12)22(13)36-3)23(37-25(11,2)26(28,29)30)16-10-17(34)20-15(33-16)8-9-32-21(20)24(31)35/h6-12,18,23H,4-5H2,1-3H3,(H2,31,35)(H,33,34)/t11-,18-,23-,25+/m1/s1 |
| InChIKey | BHZNTDUFZNDFDD-DBEWUFIKSA-N |
| XLogP | 4.86 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |