C24H22F5N3O3 — CID 178085569
2-[(3S,4R)-2-(3,4-difluoro-2-methoxyphenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178085569) has the molecular formula C24H22F5N3O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is 2-[(3S,4R)-2-(3,4-difluoro-2-methoxyphenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(3S,4R)-2-(3,4-difluoro-2-methoxyphenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178085569 |
| Molecular Formula | C24H22F5N3O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[(3S,4R)-2-(3,4-difluoro-2-methoxyphenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | COc1c(C2C(c3cc(=O)c4c(C(N)=O)nccc4[nH]3)C[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C24H22F5N3O3/c1-10-17(11-4-5-13(25)19(26)21(11)35-3)12(9-23(10,2)24(27,28)29)15-8-16(33)18-14(32-15)6-7-31-20(18)22(30)34/h4-8,10,12,17H,9H2,1-3H3,(H2,30,34)(H,32,33)/t10-,12?,17?,23+/m0/s1 |
| InChIKey | QHMBMORBLTYHTH-BIPDYZHJSA-N |
| XLogP | 4.78 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |