C23H20ClF4N3O2 — CID 178085571
2-[(1R,2R,3S,4R)-2-(3-chloro-4-fluorophenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178085571) has the molecular formula C23H20ClF4N3O2 and a molecular weight of 481.88 g/mol. Its IUPAC name is 2-[(1R,2R,3S,4R)-2-(3-chloro-4-fluorophenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(1R,2R,3S,4R)-2-(3-chloro-4-fluorophenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178085571 |
| Molecular Formula | C23H20ClF4N3O2 |
| Molecular Weight | 481.88 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 2-[(1R,2R,3S,4R)-2-(3-chloro-4-fluorophenyl)-3,4-dimethyl-4-(trifluoromethyl)cyclopentyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(Cl)c2)[C@H](c2cc(=O)c3c(C(N)=O)nccc3[nH]2)C[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C23H20ClF4N3O2/c1-10-18(11-3-4-14(25)13(24)7-11)12(9-22(10,2)23(26,27)28)16-8-17(32)19-15(31-16)5-6-30-20(19)21(29)33/h3-8,10,12,18H,9H2,1-2H3,(H2,29,33)(H,31,32)/t10-,12-,18-,22+/m0/s1 |
| InChIKey | NFINBFWYAYPYQH-KGQCTFDTSA-N |
| XLogP | 5.29 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |