C24H22F5N3O3 — CID 178085739
2-[(1R,2R,5R)-2-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)cyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178085739) has the molecular formula C24H22F5N3O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)cyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(1R,2R,5R)-2-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)cyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178085739 |
| Molecular Formula | C24H22F5N3O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[(1R,2R,5R)-2-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)cyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | COc1c([C@@H]2CC[C@@](C)(C(F)(F)F)C[C@H]2c2cc(=O)c3c(C(N)=O)nccc3[nH]2)ccc(F)c1F |
| InChI | InChI=1S/C24H22F5N3O3/c1-23(24(27,28)29)7-5-11(12-3-4-14(25)19(26)21(12)35-2)13(10-23)16-9-17(33)18-15(32-16)6-8-31-20(18)22(30)34/h3-4,6,8-9,11,13H,5,7,10H2,1-2H3,(H2,30,34)(H,32,33)/t11-,13+,23+/m0/s1 |
| InChIKey | FJYYJZYIWAMFIG-IWIWMGDJSA-N |
| XLogP | 4.93 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |