C25H22F5N3O4 — CID 176996343
2-[(2R,3S,4S,5R)-3-(2-cyclopropyl-3,4-difluorophenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 176996343) has the molecular formula C25H22F5N3O4 and a molecular weight of 523.46 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(2-cyclopropyl-3,4-difluorophenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(2-cyclopropyl-3,4-difluorophenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 176996343 |
| Molecular Formula | C25H22F5N3O4 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(2-cyclopropyl-3,4-difluorophenyl)-4-methoxy-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | CO[C@H]1[C@@H](c2ccc(F)c(F)c2C2CC2)[C@H](c2cc(=O)c3c(C(N)=O)nccc3[nH]2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C25H22F5N3O4/c1-24(25(28,29)30)22(36-2)17(11-5-6-12(26)19(27)16(11)10-3-4-10)21(37-24)14-9-15(34)18-13(33-14)7-8-32-20(18)23(31)35/h5-10,17,21-22H,3-4H2,1-2H3,(H2,31,35)(H,33,34)/t17-,21-,22-,24+/m0/s1 |
| InChIKey | IUTFWDOBUPOOEA-WLZNGNGHSA-N |
| XLogP | 4.37 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |