C27H28F5N3O4 — CID 177360214
N-tert-butyl-2-[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(trideuteriomethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 177360214) has the molecular formula C27H28F5N3O4 and a molecular weight of 556.55 g/mol. Its IUPAC name is N-tert-butyl-2-[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(trideuteriomethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | N-tert-butyl-2-[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(trideuteriomethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 177360214 |
| Molecular Formula | C27H28F5N3O4 |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | N-tert-butyl-2-[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(trideuteriomethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | [2H]C([2H])([2H])Oc1c([C@H]2[C@H](c3cc(=O)c4c(C(=O)NC(C)(C)C)nccc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C27H28F5N3O4/c1-12-18(13-7-8-14(28)20(29)22(13)38-6)23(39-26(12,5)27(30,31)32)16-11-17(36)19-15(34-16)9-10-33-21(19)24(37)35-25(2,3)4/h7-12,18,23H,1-6H3,(H,34,36)(H,35,37)/t12-,18-,23-,26+/m0/s1/i6D3 |
| InChIKey | AETMAAAOZCSMGH-KPAPVHJOSA-N |
| XLogP | 5.55 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |