C26H24F5NO6 — CID 176996307
methyl 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-methoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 176996307) has the molecular formula C26H24F5NO6 and a molecular weight of 541.47 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-methoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | methyl 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-methoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 176996307 |
| Molecular Formula | C26H24F5NO6 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | methyl 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-methoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)c1c([C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)[nH]c2cccc(OC)c2c1=O |
| InChI | InChI=1S/C26H24F5NO6/c1-11-16(12-9-10-13(27)19(28)22(12)36-4)23(38-25(11,2)26(29,30)31)20-18(24(34)37-5)21(33)17-14(32-20)7-6-8-15(17)35-3/h6-11,16,23H,1-5H3,(H,32,33)/t11-,16-,23+,25+/m0/s1 |
| InChIKey | KFURAFZFRLHZGC-QFVUWCGNSA-N |
| XLogP | 5.42 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |