C18H21F5N2O4 — CID 166160437
(2R,3S,4S,5R)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160437) has the molecular formula C18H21F5N2O4 and a molecular weight of 424.37 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160437 |
| Molecular Formula | C18H21F5N2O4 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (2R,3S,4S,5R)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)N[C@H](C)C(N)=O)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C18H21F5N2O4/c1-7-11(9-5-6-10(19)12(20)13(9)28-4)14(16(27)25-8(2)15(24)26)29-17(7,3)18(21,22)23/h5-8,11,14H,1-4H3,(H2,24,26)(H,25,27)/t7-,8+,11-,14+,17+/m0/s1 |
| InChIKey | QENUZNXNVRIYLP-XTXBZQTMSA-N |
| XLogP | 2.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |