C20H22F5N3O3 — CID 166161025
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166161025) has the molecular formula C20H22F5N3O3 and a molecular weight of 447.40 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161025 |
| Molecular Formula | C20H22F5N3O3 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)N[C@@H](C)c3ccn[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H22F5N3O3/c1-9-14(11-5-6-12(21)15(22)16(11)30-4)17(31-19(9,3)20(23,24)25)18(29)27-10(2)13-7-8-26-28-13/h5-10,14,17H,1-4H3,(H,26,28)(H,27,29)/t9-,10-,14-,17+,19+/m0/s1 |
| InChIKey | VWMQNGYNSFBTHT-GJHJFNQVSA-N |
| XLogP | 4.01 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |