C22H24F5N3O4 — CID 166160486
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-hydroxypropan-2-yl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160486) has the molecular formula C22H24F5N3O4 and a molecular weight of 489.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-hydroxypropan-2-yl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-hydroxypropan-2-yl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160486 |
| Molecular Formula | C22H24F5N3O4 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-hydroxypropan-2-yl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cnnc(C(C)(C)O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H24F5N3O4/c1-10-15(12-6-7-13(23)16(24)17(12)33-5)18(34-21(10,4)22(25,26)27)19(31)29-11-8-14(20(2,3)32)30-28-9-11/h6-10,15,18,32H,1-5H3,(H,29,30,31)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | RGQKPZMQIHHYAM-TZDAZOALSA-N |
| XLogP | 4.07 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |