C22H26F5N3O3 — CID 166160222
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160222) has the molecular formula C22H26F5N3O3 and a molecular weight of 475.46 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160222 |
| Molecular Formula | C22H26F5N3O3 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)NCCc3c(C)n[nH]c3C)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H26F5N3O3/c1-10-16(14-6-7-15(23)17(24)18(14)32-5)19(33-21(10,4)22(25,26)27)20(31)28-9-8-13-11(2)29-30-12(13)3/h6-7,10,16,19H,8-9H2,1-5H3,(H,28,31)(H,29,30)/t10-,16-,19+,21+/m0/s1 |
| InChIKey | LOKHKGPHLPKZGM-BKARRUBJSA-N |
| XLogP | 4.11 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |