C23H24F7N3O4 — CID 166160256
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(3-hydroxycyclobutyl)oxyphenyl]-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160256) has the molecular formula C23H24F7N3O4 and a molecular weight of 539.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(3-hydroxycyclobutyl)oxyphenyl]-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(3-hydroxycyclobutyl)oxyphenyl]-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160256 |
| Molecular Formula | C23H24F7N3O4 |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(3-hydroxycyclobutyl)oxyphenyl]-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1nn(C(F)F)cc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1ccc(F)c(F)c1OC1CC(O)C1 |
| InChI | InChI=1S/C23H24F7N3O4/c1-9-16(13-4-5-14(24)17(25)18(13)36-12-6-11(34)7-12)19(37-22(9,3)23(28,29)30)20(35)31-15-8-33(21(26)27)32-10(15)2/h4-5,8-9,11-12,16,19,21,34H,6-7H2,1-3H3,(H,31,35)/t9-,11?,12?,16-,19+,22+/m0/s1 |
| InChIKey | XIZZPRUWPMKZRT-FXYJFKPOSA-N |
| XLogP | 4.85 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |