C22H27F5N2O4 — CID 166160803
(2R,3S,4S,5R)-N-(1-acetylpiperidin-4-yl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160803) has the molecular formula C22H27F5N2O4 and a molecular weight of 478.46 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-(1-acetylpiperidin-4-yl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-(1-acetylpiperidin-4-yl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160803 |
| Molecular Formula | C22H27F5N2O4 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (2R,3S,4S,5R)-N-(1-acetylpiperidin-4-yl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)NC3CCN(C(C)=O)CC3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H27F5N2O4/c1-11-16(14-5-6-15(23)17(24)18(14)32-4)19(33-21(11,3)22(25,26)27)20(31)28-13-7-9-29(10-8-13)12(2)30/h5-6,11,13,16,19H,7-10H2,1-4H3,(H,28,31)/t11-,16-,19+,21+/m0/s1 |
| InChIKey | ARDJZOYGCLIJDT-YFVHLLGCSA-N |
| XLogP | 3.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |