C22H26F5N3O4 — CID 176860243
(1R,4S)-5-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 176860243) has the molecular formula C22H26F5N3O4 and a molecular weight of 491.46 g/mol. Its IUPAC name is (1R,4S)-5-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,4S)-5-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 176860243 |
| Molecular Formula | C22H26F5N3O4 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (1R,4S)-5-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)NC3C[C@H]4C[C@@H]3C(C(N)=O)N4)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H26F5N3O4/c1-8-14(10-4-5-12(23)15(24)17(10)33-3)18(34-21(8,2)22(25,26)27)20(32)30-13-7-9-6-11(13)16(29-9)19(28)31/h4-5,8-9,11,13-14,16,18,29H,6-7H2,1-3H3,(H2,28,31)(H,30,32)/t8-,9+,11-,13?,14-,16?,18+,21+/m0/s1 |
| InChIKey | DBMNTMRUSXJTBY-NIIARYKSSA-N |
| XLogP | 2.13 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |