C22H20F5N3O4 — CID 170973009
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(1-oxo-2H-pyrrolo[1,2-a]pyrazin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170973009) has the molecular formula C22H20F5N3O4 and a molecular weight of 485.41 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(1-oxo-2H-pyrrolo[1,2-a]pyrazin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(1-oxo-2H-pyrrolo[1,2-a]pyrazin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170973009 |
| Molecular Formula | C22H20F5N3O4 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(1-oxo-2H-pyrrolo[1,2-a]pyrazin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc4c(=O)[nH]ccn34)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H20F5N3O4/c1-10-15(11-4-5-12(23)16(24)17(11)33-3)18(34-21(10,2)22(25,26)27)20(32)29-14-7-6-13-19(31)28-8-9-30(13)14/h4-10,15,18H,1-3H3,(H,28,31)(H,29,32)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | POLMBTAOVJGYMK-TZDAZOALSA-N |
| XLogP | 3.99 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |