C20H18F5N3O6 — CID 178077957
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5-nitro-2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 178077957) has the molecular formula C20H18F5N3O6 and a molecular weight of 491.37 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5-nitro-2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5-nitro-2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 178077957 |
| Molecular Formula | C20H18F5N3O6 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5-nitro-2-oxo-1H-pyridin-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(=O)[nH]cc3[N+](=O)[O-])O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H18F5N3O6/c1-8-14(9-4-5-10(21)15(22)16(9)33-3)17(34-19(8,2)20(23,24)25)18(30)27-11-6-13(29)26-7-12(11)28(31)32/h4-8,14,17H,1-3H3,(H2,26,27,29,30)/t8-,14-,17+,19+/m0/s1 |
| InChIKey | JLKREGVSIPQIDC-NSVWJKCTSA-N |
| XLogP | 3.65 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|