C21H20F5N3O6 — CID 178077985
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-(2-methoxy-5-nitro-4-pyridinyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 178077985) has the molecular formula C21H20F5N3O6 and a molecular weight of 505.40 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-(2-methoxy-5-nitro-4-pyridinyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-(2-methoxy-5-nitro-4-pyridinyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 178077985 |
| Molecular Formula | C21H20F5N3O6 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-(2-methoxy-5-nitro-4-pyridinyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H20F5N3O6/c1-9-15(10-5-6-11(22)16(23)17(10)34-4)18(35-20(9,2)21(24,25)26)19(30)28-12-7-14(33-3)27-8-13(12)29(31)32/h5-9,15,18H,1-4H3,(H,27,28,30)/t9-,15-,18+,20+/m0/s1 |
| InChIKey | BDMZJGPKCWUOBR-AABHQCRUSA-N |
| XLogP | 4.36 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|