C20H18F5N5O3 — CID 176860220
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-d]pyridazine-4-carboxamide (PubChem CID 176860220) has the molecular formula C20H18F5N5O3 and a molecular weight of 471.39 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-d]pyridazine-4-carboxamide.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-d]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 176860220 |
| Molecular Formula | C20H18F5N5O3 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-d]pyridazine-4-carboxamide |
| SMILES | COc1c([C@H]2[C@H](c3nc4c(C(N)=O)nncc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H18F5N5O3/c1-7-11(8-4-5-9(21)12(22)15(8)32-3)16(33-19(7,2)20(23,24)25)18-28-10-6-27-30-14(17(26)31)13(10)29-18/h4-7,11,16H,1-3H3,(H2,26,31)(H,28,29)/t7-,11-,16+,19+/m0/s1 |
| InChIKey | SMEDVIYEOVSUGG-VUSDOQBQSA-N |
| XLogP | 3.55 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |