C20H19F5N2NiO3-2 — CID 177218289
[2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-ethenyl-1H-imidazol-4-yl]methylidenenickel hydroxide (PubChem CID 177218289) has the molecular formula C20H19F5N2NiO3-2 and a molecular weight of 489.07 g/mol. Its IUPAC name is [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-ethenyl-1H-imidazol-4-yl]methylidenenickel hydroxide.
| Compound Name | [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-ethenyl-1H-imidazol-4-yl]methylidenenickel hydroxide |
|---|---|
| PubChem CID | 177218289 |
| Molecular Formula | C20H19F5N2NiO3-2 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | [2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-ethenyl-1H-imidazol-4-yl]methylidenenickel hydroxide |
| SMILES | [H]/[C-]=C/c1[nH]c([C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)nc1C=[Ni].[OH-] |
| InChI | InChI=1S/C20H18F5N2O2.Ni.H2O/c1-6-13-10(3)26-18(27-13)17-14(9(2)19(4,29-17)20(23,24)25)11-7-8-12(21)15(22)16(11)28-5;;/h1,3,6-9,14,17H,2,4-5H3,(H,26,27);;1H2/q-1;;/p-1/t9-,14-,17+,19+;;/m0../s1 |
| InChIKey | XYRZWIRIMUBFMS-LWOFSLDISA-M |
| XLogP | 4.48 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|