C21H20F5N4O4+ — CID 176860307
2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-hydroxy-1H-imidazo[4,5-c]pyridin-5-ium-4-carboxamide (PubChem CID 176860307) has the molecular formula C21H20F5N4O4+ and a molecular weight of 487.41 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-hydroxy-1H-imidazo[4,5-c]pyridin-5-ium-4-carboxamide.
| Compound Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-hydroxy-1H-imidazo[4,5-c]pyridin-5-ium-4-carboxamide |
|---|---|
| PubChem CID | 176860307 |
| Molecular Formula | C21H20F5N4O4+ |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-5-hydroxy-1H-imidazo[4,5-c]pyridin-5-ium-4-carboxamide |
| SMILES | COc1c([C@H]2[C@H](c3nc4c(C(N)=O)[n+](O)ccc4[nH]3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H19F5N4O4/c1-8-12(9-4-5-10(22)13(23)16(9)33-3)17(34-20(8,2)21(24,25)26)19-28-11-6-7-30(32)15(18(27)31)14(11)29-19/h4-8,12,17,32H,1-3H3,(H2,27,31)/p+1/t8-,12-,17+,20+/m0/s1 |
| InChIKey | AXKOPGCRWWKVCB-HHTRBMLDSA-O |
| XLogP | 3.29 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|