C23H24F4N4O2 — CID 177218335
1-[2-[(2R,3S,4S,5R)-3-(3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-4-yl]cyclopropan-1-amine (PubChem CID 177218335) has the molecular formula C23H24F4N4O2 and a molecular weight of 464.46 g/mol. Its IUPAC name is 1-[2-[(2R,3S,4S,5R)-3-(3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-4-yl]cyclopropan-1-amine.
| Compound Name | 1-[2-[(2R,3S,4S,5R)-3-(3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-4-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 177218335 |
| Molecular Formula | C23H24F4N4O2 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-[2-[(2R,3S,4S,5R)-3-(3-fluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-1H-imidazo[4,5-c]pyridin-4-yl]cyclopropan-1-amine |
| SMILES | COc1c(F)cccc1[C@H]1[C@H](c2nc3c(C4(N)CC4)nccc3[nH]2)O[C@@](C)(C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C23H24F4N4O2/c1-11-15(12-5-4-6-13(24)17(12)32-3)18(33-21(11,2)23(25,26)27)20-30-14-7-10-29-19(16(14)31-20)22(28)8-9-22/h4-7,10-11,15,18H,8-9,28H2,1-3H3,(H,30,31)/t11-,15-,18+,21+/m0/s1 |
| InChIKey | ZFPBKQRJGBXUCS-DOBNQBSTSA-N |
| XLogP | 4.87 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |