C27H32F5NO6 — CID 176996736
ethyl 2-[2-[6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-2-methyl-4-oxo-1H-pyridin-3-yl]propoxy]acetate (PubChem CID 176996736) has the molecular formula C27H32F5NO6 and a molecular weight of 561.54 g/mol. Its IUPAC name is ethyl 2-[2-[6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-2-methyl-4-oxo-1H-pyridin-3-yl]propoxy]acetate.
| Compound Name | ethyl 2-[2-[6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-2-methyl-4-oxo-1H-pyridin-3-yl]propoxy]acetate |
|---|---|
| PubChem CID | 176996736 |
| Molecular Formula | C27H32F5NO6 |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | ethyl 2-[2-[6-[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl]-2-methyl-4-oxo-1H-pyridin-3-yl]propoxy]acetate |
| SMILES | CCOC(=O)COCC(C)c1c(C)[nH]c([C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)cc1=O |
| InChI | InChI=1S/C27H32F5NO6/c1-7-38-20(35)12-37-11-13(2)21-15(4)33-18(10-19(21)34)25-22(14(3)26(5,39-25)27(30,31)32)16-8-9-17(28)23(29)24(16)36-6/h8-10,13-14,22,25H,7,11-12H2,1-6H3,(H,33,34)/t13?,14-,22-,25-,26+/m0/s1 |
| InChIKey | GBVZVVCGWQWDGT-DSRPLUBPSA-N |
| XLogP | 5.47 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |