C9H10N2O5 — CID 143061205
6-[2-(carboxyamino)-1-hydroxyethyl]pyridine-3-carboxylic acid (PubChem CID 143061205) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 6-[2-(carboxyamino)-1-hydroxyethyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(carboxyamino)-1-hydroxyethyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143061205 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 6-[2-(carboxyamino)-1-hydroxyethyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)NCC(O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H10N2O5/c12-7(4-11-9(15)16)6-2-1-5(3-10-6)8(13)14/h1-3,7,11-12H,4H2,(H,13,14)(H,15,16) |
| InChIKey | LMFVKJCYJCZFKH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |