C6H10ClN3O2 — CID 171861448
1-(5-amino-1H-pyrazol-4-yl)-3-chloropropane-1,2-diol (PubChem CID 171861448) has the molecular formula C6H10ClN3O2 and a molecular weight of 191.62 g/mol. Its IUPAC name is 1-(5-amino-1H-pyrazol-4-yl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(5-amino-1H-pyrazol-4-yl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171861448 |
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 1-(5-amino-1H-pyrazol-4-yl)-3-chloropropane-1,2-diol |
| SMILES | Nc1[nH]ncc1C(O)C(O)CCl |
| InChI | InChI=1S/C6H10ClN3O2/c7-1-4(11)5(12)3-2-9-10-6(3)8/h2,4-5,11-12H,1H2,(H3,8,9,10) |
| InChIKey | IRCHCKPILZXKFW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|