C10H19N3O — CID 83161431
1-(5-amino-1H-pyrazol-4-yl)-5-methylhexan-1-ol (PubChem CID 83161431) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(5-amino-1H-pyrazol-4-yl)-5-methylhexan-1-ol.
| Compound Name | 1-(5-amino-1H-pyrazol-4-yl)-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 83161431 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(5-amino-1H-pyrazol-4-yl)-5-methylhexan-1-ol |
| SMILES | CC(C)CCCC(O)c1cn[nH]c1N |
| InChI | InChI=1S/C10H19N3O/c1-7(2)4-3-5-9(14)8-6-12-13-10(8)11/h6-7,9,14H,3-5H2,1-2H3,(H3,11,12,13) |
| InChIKey | CFFHXAODSWRTRY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |