C7H13N5 — CID 105231296
4-(1-hydrazinyl-2-methylprop-2-enyl)-1H-pyrazol-5-amine (PubChem CID 105231296) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 4-(1-hydrazinyl-2-methylprop-2-enyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(1-hydrazinyl-2-methylprop-2-enyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231296 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 4-(1-hydrazinyl-2-methylprop-2-enyl)-1H-pyrazol-5-amine |
| SMILES | C=C(C)C(NN)c1cn[nH]c1N |
| InChI | InChI=1S/C7H13N5/c1-4(2)6(11-9)5-3-10-12-7(5)8/h3,6,11H,1,9H2,2H3,(H3,8,10,12) |
| InChIKey | HLUODOUGNOAMBR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|