C6H11N5 — CID 105231055
4-(1-hydrazinylprop-2-enyl)-1H-pyrazol-5-amine (PubChem CID 105231055) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 4-(1-hydrazinylprop-2-enyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(1-hydrazinylprop-2-enyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231055 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 4-(1-hydrazinylprop-2-enyl)-1H-pyrazol-5-amine |
| SMILES | C=CC(NN)c1cn[nH]c1N |
| InChI | InChI=1S/C6H11N5/c1-2-5(10-8)4-3-9-11-6(4)7/h2-3,5,10H,1,8H2,(H3,7,9,11) |
| InChIKey | GAQQCWQHBWHTPH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|