C9H19N5 — CID 105231014
4-(2-ethyl-1-hydrazinylbutyl)-1H-pyrazol-5-amine (PubChem CID 105231014) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 4-(2-ethyl-1-hydrazinylbutyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-ethyl-1-hydrazinylbutyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231014 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 4-(2-ethyl-1-hydrazinylbutyl)-1H-pyrazol-5-amine |
| SMILES | CCC(CC)C(NN)c1cn[nH]c1N |
| InChI | InChI=1S/C9H19N5/c1-3-6(4-2)8(13-11)7-5-12-14-9(7)10/h5-6,8,13H,3-4,11H2,1-2H3,(H3,10,12,14) |
| InChIKey | GGQRTORKSYMLQE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|