C12H22N4 — CID 105324133
[1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutyl]hydrazine (PubChem CID 105324133) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutyl]hydrazine.
| Compound Name | [1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutyl]hydrazine |
|---|---|
| PubChem CID | 105324133 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutyl]hydrazine |
| SMILES | CCC(CC)C(NN)c1cc(C)nnc1C |
| InChI | InChI=1S/C12H22N4/c1-5-10(6-2)12(14-13)11-7-8(3)15-16-9(11)4/h7,10,12,14H,5-6,13H2,1-4H3 |
| InChIKey | LCKQUXPPEUTYPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|