C8H13N3 — CID 105082248
1-(3,6-dimethylpyridazin-4-yl)ethanamine (PubChem CID 105082248) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)ethanamine.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)ethanamine |
|---|---|
| PubChem CID | 105082248 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)ethanamine |
| SMILES | Cc1cc(C(C)N)c(C)nn1 |
| InChI | InChI=1S/C8H13N3/c1-5-4-8(6(2)9)7(3)11-10-5/h4,6H,9H2,1-3H3 |
| InChIKey | QEFVFZJUMFMFCJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |