C10H15N3 — CID 105163714
1-(3,6-dimethylpyridazin-4-yl)-2-methylprop-2-en-1-amine (PubChem CID 105163714) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-2-methylprop-2-en-1-amine.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105163714 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)C(N)c1cc(C)nnc1C |
| InChI | InChI=1S/C10H15N3/c1-6(2)10(11)9-5-7(3)12-13-8(9)4/h5,10H,1,11H2,2-4H3 |
| InChIKey | HNJYCKGFHIVKKY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|