C14H25N3 — CID 114210905
1-(3,6-dimethylpyridazin-4-yl)-5,5-dimethylhexan-1-amine (PubChem CID 114210905) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-5,5-dimethylhexan-1-amine.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-5,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114210905 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-5,5-dimethylhexan-1-amine |
| SMILES | Cc1cc(C(N)CCCC(C)(C)C)c(C)nn1 |
| InChI | InChI=1S/C14H25N3/c1-10-9-12(11(2)17-16-10)13(15)7-6-8-14(3,4)5/h9,13H,6-8,15H2,1-5H3 |
| InChIKey | BYDSCLRGXAWIHQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |