C13H24N4 — CID 105294084
1-(3,6-dimethylpyridazin-4-yl)heptylhydrazine (PubChem CID 105294084) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)heptylhydrazine.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)heptylhydrazine |
|---|---|
| PubChem CID | 105294084 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)heptylhydrazine |
| SMILES | CCCCCCC(NN)c1cc(C)nnc1C |
| InChI | InChI=1S/C13H24N4/c1-4-5-6-7-8-13(15-14)12-9-10(2)16-17-11(12)3/h9,13,15H,4-8,14H2,1-3H3 |
| InChIKey | FEGWKJDMWJNENN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|